C11H12O3S — CID 100930005
(2E,4Z)-5-(benzenesulfonyl)penta-2,4-dien-1-ol (PubChem CID 100930005) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is (2E,4Z)-5-(benzenesulfonyl)penta-2,4-dien-1-ol.
| Compound Name | (2E,4Z)-5-(benzenesulfonyl)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 100930005 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | (2E,4Z)-5-(benzenesulfonyl)penta-2,4-dien-1-ol |
| SMILES | O=S(=O)(/C=C\C=C\CO)c1ccccc1 |
| InChI | InChI=1S/C11H12O3S/c12-9-5-2-6-10-15(13,14)11-7-3-1-4-8-11/h1-8,10,12H,9H2/b5-2+,10-6- |
| InChIKey | GDVXPUHHWUYALV-WFSLVTIPSA-N |
| XLogP | 1.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|