C17H22O2S — CID 134980499
[(1Z,7E,9Z)-undeca-1,7,9-trienyl]sulfonylbenzene (PubChem CID 134980499) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is [(1Z,7E,9Z)-undeca-1,7,9-trienyl]sulfonylbenzene.
| Compound Name | [(1Z,7E,9Z)-undeca-1,7,9-trienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 134980499 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(1Z,7E,9Z)-undeca-1,7,9-trienyl]sulfonylbenzene |
| SMILES | C/C=C\C=C\CCCC/C=C\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O2S/c1-2-3-4-5-6-7-8-9-13-16-20(18,19)17-14-11-10-12-15-17/h2-5,10-16H,6-9H2,1H3/b3-2-,5-4+,16-13- |
| InChIKey | QWBRFMOSFYXLCU-JDIXWECQSA-N |
| XLogP | 4.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|