C17H20O2S — CID 15469640
[(8E)-undeca-1,2,8,10-tetraenyl]sulfonylbenzene (PubChem CID 15469640) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is [(8E)-undeca-1,2,8,10-tetraenyl]sulfonylbenzene.
| Compound Name | [(8E)-undeca-1,2,8,10-tetraenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 15469640 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [(8E)-undeca-1,2,8,10-tetraenyl]sulfonylbenzene |
| SMILES | C=C/C=C/CCCCC=C=CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O2S/c1-2-3-4-5-6-7-8-9-13-16-20(18,19)17-14-11-10-12-15-17/h2-4,9-12,14-16H,1,5-8H2/b4-3+ |
| InChIKey | ONIPBABHBPKUSZ-ONEGZZNKSA-N |
| XLogP | 4.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|