About CID 88513820
CID 88513820 (PubChem CID 88513820) has the molecular formula C18H14BiO8S2
and a molecular weight of 631.42 g/mol.
Molecular Properties
| Compound Name | CID 88513820 |
| PubChem CID | 88513820 |
| Molecular Formula | C18H14BiO8S2 |
| Molecular Weight | 631.42 g/mol |
| Exact Mass | 630.99 |
| IUPAC Name | — |
| SMILES | O=C([O-])/C=C/S(=O)(=O)c1ccccc1.O=C([O-])/C=C/S(=O)(=O)c1ccccc1.[Bi+2] |
| InChI | InChI=1S/2C9H8O4S.Bi/c2*10-9(11)6-7-14(12,13)8-4-2-1-3-5-8;/h2*1-7H,(H,10,11);/q;;+2/p-2/b2*7-6+; |
| InChIKey | ACWGXQPESVRJRS-RWUXNGIBSA-L |
| XLogP | -0.93 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 631.42 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 88513820 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88513820?
The IUPAC name of CID 88513820 (CID 88513820) is not available.
What is the SMILES notation for CID 88513820?
The canonical SMILES for CID 88513820 is O=C([O-])/C=C/S(=O)(=O)c1ccccc1.O=C([O-])/C=C/S(=O)(=O)c1ccccc1.[Bi+2].
What is the InChIKey of CID 88513820?
The InChIKey is ACWGXQPESVRJRS-RWUXNGIBSA-L. The full InChI is InChI=1S/2C9H8O4S.Bi/c2*10-9(11)6-7-14(12,13)8-4-2-1-3-5-8;/h2*1-7H,(H,10,11);/q;;+2/p-2/b2*7-6+;.
What are the key properties of CID 88513820?
CID 88513820 has a molecular weight of 631.42 g/mol, XLogP of -0.93, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88513820 is sourced from PubChem (CID 88513820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).