C18H18O6S2 — CID 11058334
methyl (E)-5,5-bis(benzenesulfonyl)pent-2-enoate (PubChem CID 11058334) has the molecular formula C18H18O6S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl (E)-5,5-bis(benzenesulfonyl)pent-2-enoate.
| Compound Name | methyl (E)-5,5-bis(benzenesulfonyl)pent-2-enoate |
|---|---|
| PubChem CID | 11058334 |
| Molecular Formula | C18H18O6S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | methyl (E)-5,5-bis(benzenesulfonyl)pent-2-enoate |
| SMILES | COC(=O)/C=C/CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O6S2/c1-24-17(19)13-8-14-18(25(20,21)15-9-4-2-5-10-15)26(22,23)16-11-6-3-7-12-16/h2-13,18H,14H2,1H3/b13-8+ |
| InChIKey | BGPKEIDODXNRPJ-MDWZMJQESA-N |
| XLogP | 2.38 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|