C16H14O10S3 — CID 13263040
2-[4-[4-(carboxymethylsulfonyl)phenyl]sulfonylphenyl]sulfonylacetic acid (PubChem CID 13263040) has the molecular formula C16H14O10S3 and a molecular weight of 462.48 g/mol. Its IUPAC name is 2-[4-[4-(carboxymethylsulfonyl)phenyl]sulfonylphenyl]sulfonylacetic acid.
| Compound Name | 2-[4-[4-(carboxymethylsulfonyl)phenyl]sulfonylphenyl]sulfonylacetic acid |
|---|---|
| PubChem CID | 13263040 |
| Molecular Formula | C16H14O10S3 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 2-[4-[4-(carboxymethylsulfonyl)phenyl]sulfonylphenyl]sulfonylacetic acid |
| SMILES | O=C(O)CS(=O)(=O)c1ccc(S(=O)(=O)c2ccc(S(=O)(=O)CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H14O10S3/c17-15(18)9-27(21,22)11-1-5-13(6-2-11)29(25,26)14-7-3-12(4-8-14)28(23,24)10-16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | NWBFXDMMYGVNEM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |