C18H18O4S2 — CID 10570649
1-methyl-4-[(1E,3E)-4-(4-methylphenyl)sulfonylbuta-1,3-dienyl]sulfonylbenzene (PubChem CID 10570649) has the molecular formula C18H18O4S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)sulfonylbuta-1,3-dienyl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)sulfonylbuta-1,3-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 10570649 |
| Molecular Formula | C18H18O4S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-methyl-4-[(1E,3E)-4-(4-methylphenyl)sulfonylbuta-1,3-dienyl]sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/C=C/S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H18O4S2/c1-15-5-9-17(10-6-15)23(19,20)13-3-4-14-24(21,22)18-11-7-16(2)8-12-18/h3-14H,1-2H3/b13-3+,14-4+ |
| InChIKey | SMDPFCZEMNOJPN-NPJRDEIVSA-N |
| XLogP | 3.58 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|