C15H12Cl2O4S2 — CID 100976770
1,2-dichloro-4-[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylbenzene (PubChem CID 100976770) has the molecular formula C15H12Cl2O4S2 and a molecular weight of 391.30 g/mol. Its IUPAC name is 1,2-dichloro-4-[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylbenzene.
| Compound Name | 1,2-dichloro-4-[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 100976770 |
| Molecular Formula | C15H12Cl2O4S2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 1,2-dichloro-4-[(E)-2-(4-methylphenyl)sulfonylethenyl]sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/S(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H12Cl2O4S2/c1-11-2-4-12(5-3-11)22(18,19)8-9-23(20,21)13-6-7-14(16)15(17)10-13/h2-10H,1H3/b9-8+ |
| InChIKey | LHRKOFXOWNRCPO-CMDGGOBGSA-N |
| XLogP | 4.02 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |