About fluoromethane;4-methylbenzenesulfonyl chloride
fluoromethane;4-methylbenzenesulfonyl chloride (PubChem CID 91127409) has the molecular formula C8H10ClFO2S
and a molecular weight of 224.68 g/mol. Its IUPAC name is fluoromethane;4-methylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | fluoromethane;4-methylbenzenesulfonyl chloride |
| PubChem CID | 91127409 |
| Molecular Formula | C8H10ClFO2S |
| Molecular Weight | 224.68 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | fluoromethane;4-methylbenzenesulfonyl chloride |
| SMILES | CF.Cc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C7H7ClO2S.CH3F/c1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2-5H,1H3;1H3 |
| InChIKey | JAPYJWIIFVTGHY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoromethane;4-methylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;4-methylbenzenesulfonyl chloride?
The IUPAC name of fluoromethane;4-methylbenzenesulfonyl chloride (CID 91127409) is fluoromethane;4-methylbenzenesulfonyl chloride.
What is the SMILES notation for fluoromethane;4-methylbenzenesulfonyl chloride?
The canonical SMILES for fluoromethane;4-methylbenzenesulfonyl chloride is CF.Cc1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of fluoromethane;4-methylbenzenesulfonyl chloride?
The InChIKey is JAPYJWIIFVTGHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO2S.CH3F/c1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2-5H,1H3;1H3.
What are the key properties of fluoromethane;4-methylbenzenesulfonyl chloride?
fluoromethane;4-methylbenzenesulfonyl chloride has a molecular weight of 224.68 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;4-methylbenzenesulfonyl chloride is sourced from PubChem (CID 91127409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).