fluoromethane;4-methylbenzenesulfonyl chloride

C8H10ClFO2S — CID 91127409

IUPACfluoromethane;4-methylbenzenesulfonyl chloride
SMILESCF.Cc1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C7H7ClO2S.CH3F/c1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2-5H,1H3;1H3
InChIKeyJAPYJWIIFVTGHY-UHFFFAOYSA-N
MW224.68 g/mol
LogP2.51
Rot. Bonds1

About fluoromethane;4-methylbenzenesulfonyl chloride

fluoromethane;4-methylbenzenesulfonyl chloride (PubChem CID 91127409) has the molecular formula C8H10ClFO2S and a molecular weight of 224.68 g/mol. Its IUPAC name is fluoromethane;4-methylbenzenesulfonyl chloride.

Molecular Properties

Compound Namefluoromethane;4-methylbenzenesulfonyl chloride
PubChem CID91127409
Molecular FormulaC8H10ClFO2S
Molecular Weight224.68 g/mol
Exact Mass224.01
IUPAC Namefluoromethane;4-methylbenzenesulfonyl chloride
SMILESCF.Cc1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C7H7ClO2S.CH3F/c1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2-5H,1H3;1H3
InChIKeyJAPYJWIIFVTGHY-UHFFFAOYSA-N
XLogP2.51
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.68
LogP ≤ 52.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze fluoromethane;4-methylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoromethane;4-methylbenzenesulfonyl chloride?
The IUPAC name of fluoromethane;4-methylbenzenesulfonyl chloride (CID 91127409) is fluoromethane;4-methylbenzenesulfonyl chloride.
What is the SMILES notation for fluoromethane;4-methylbenzenesulfonyl chloride?
The canonical SMILES for fluoromethane;4-methylbenzenesulfonyl chloride is CF.Cc1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of fluoromethane;4-methylbenzenesulfonyl chloride?
The InChIKey is JAPYJWIIFVTGHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO2S.CH3F/c1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2-5H,1H3;1H3.
What are the key properties of fluoromethane;4-methylbenzenesulfonyl chloride?
fluoromethane;4-methylbenzenesulfonyl chloride has a molecular weight of 224.68 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;4-methylbenzenesulfonyl chloride is sourced from PubChem (CID 91127409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).