About N-methylaniline;4-methylbenzenesulfonyl chloride
N-methylaniline;4-methylbenzenesulfonyl chloride (PubChem CID 175068196) has the molecular formula C14H16ClNO2S
and a molecular weight of 297.81 g/mol. Its IUPAC name is N-methylaniline;4-methylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | N-methylaniline;4-methylbenzenesulfonyl chloride |
| PubChem CID | 175068196 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-methylaniline;4-methylbenzenesulfonyl chloride |
| SMILES | CNc1ccccc1.Cc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C7H7ClO2S.C7H9N/c1-6-2-4-7(5-3-6)11(8,9)10;1-8-7-5-3-2-4-6-7/h2-5H,1H3;2-6,8H,1H3 |
| InChIKey | MYSDOQXWBBRBMY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylaniline;4-methylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylaniline;4-methylbenzenesulfonyl chloride?
The IUPAC name of N-methylaniline;4-methylbenzenesulfonyl chloride (CID 175068196) is N-methylaniline;4-methylbenzenesulfonyl chloride.
What is the SMILES notation for N-methylaniline;4-methylbenzenesulfonyl chloride?
The canonical SMILES for N-methylaniline;4-methylbenzenesulfonyl chloride is CNc1ccccc1.Cc1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of N-methylaniline;4-methylbenzenesulfonyl chloride?
The InChIKey is MYSDOQXWBBRBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO2S.C7H9N/c1-6-2-4-7(5-3-6)11(8,9)10;1-8-7-5-3-2-4-6-7/h2-5H,1H3;2-6,8H,1H3.
What are the key properties of N-methylaniline;4-methylbenzenesulfonyl chloride?
N-methylaniline;4-methylbenzenesulfonyl chloride has a molecular weight of 297.81 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylaniline;4-methylbenzenesulfonyl chloride is sourced from PubChem (CID 175068196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).