About N-anilinohydroxylamine;4-methylbenzenesulfonic acid
N-anilinohydroxylamine;4-methylbenzenesulfonic acid (PubChem CID 174689874) has the molecular formula C13H16N2O4S
and a molecular weight of 296.35 g/mol. Its IUPAC name is N-anilinohydroxylamine;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | N-anilinohydroxylamine;4-methylbenzenesulfonic acid |
| PubChem CID | 174689874 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-anilinohydroxylamine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.ONNc1ccccc1 |
| InChI | InChI=1S/C7H8O3S.C6H8N2O/c1-6-2-4-7(5-3-6)11(8,9)10;9-8-7-6-4-2-1-3-5-6/h2-5H,1H3,(H,8,9,10);1-5,7-9H |
| InChIKey | QBTPZHWLVANXQZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-anilinohydroxylamine;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-anilinohydroxylamine;4-methylbenzenesulfonic acid?
The IUPAC name of N-anilinohydroxylamine;4-methylbenzenesulfonic acid (CID 174689874) is N-anilinohydroxylamine;4-methylbenzenesulfonic acid.
What is the SMILES notation for N-anilinohydroxylamine;4-methylbenzenesulfonic acid?
The canonical SMILES for N-anilinohydroxylamine;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.ONNc1ccccc1.
What is the InChIKey of N-anilinohydroxylamine;4-methylbenzenesulfonic acid?
The InChIKey is QBTPZHWLVANXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C6H8N2O/c1-6-2-4-7(5-3-6)11(8,9)10;9-8-7-6-4-2-1-3-5-6/h2-5H,1H3,(H,8,9,10);1-5,7-9H.
What are the key properties of N-anilinohydroxylamine;4-methylbenzenesulfonic acid?
N-anilinohydroxylamine;4-methylbenzenesulfonic acid has a molecular weight of 296.35 g/mol, XLogP of 2.23, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-anilinohydroxylamine;4-methylbenzenesulfonic acid is sourced from PubChem (CID 174689874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).