C29H33NO4S2 — CID 23341933
methanamine;bis(1-methyl-4-(4-methylphenyl)sulfonylbenzene) (PubChem CID 23341933) has the molecular formula C29H33NO4S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is methanamine;bis(1-methyl-4-(4-methylphenyl)sulfonylbenzene).
| Compound Name | methanamine;bis(1-methyl-4-(4-methylphenyl)sulfonylbenzene) |
|---|---|
| PubChem CID | 23341933 |
| Molecular Formula | C29H33NO4S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | methanamine;bis(1-methyl-4-(4-methylphenyl)sulfonylbenzene) |
| SMILES | CN.Cc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1.Cc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/2C14H14O2S.CH5N/c2*1-11-3-7-13(8-4-11)17(15,16)14-9-5-12(2)6-10-14;1-2/h2*3-10H,1-2H3;2H2,1H3 |
| InChIKey | FIABKDSBQFDGFT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |