C13H11BrO2S — CID 11426909
1-(4-bromophenyl)sulfonyl-4-methylbenzene (PubChem CID 11426909) has the molecular formula C13H11BrO2S and a molecular weight of 311.20 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-4-methylbenzene.
| Compound Name | 1-(4-bromophenyl)sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 11426909 |
| Molecular Formula | C13H11BrO2S |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C13H11BrO2S/c1-10-2-6-12(7-3-10)17(15,16)13-8-4-11(14)5-9-13/h2-9H,1H3 |
| InChIKey | HFORIYQHAWLZJQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |