C20H14Br2O6S2 — CID 23048682
2,5-dibromo-3,6-bis-(4-methylphenyl)sulfonylcyclohexa-2,5-diene-1,4-dione (PubChem CID 23048682) has the molecular formula C20H14Br2O6S2 and a molecular weight of 574.27 g/mol. Its IUPAC name is 2,5-dibromo-3,6-bis-(4-methylphenyl)sulfonylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dibromo-3,6-bis-(4-methylphenyl)sulfonylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 23048682 |
| Molecular Formula | C20H14Br2O6S2 |
| Molecular Weight | 574.27 g/mol |
| Exact Mass | 571.86 |
| IUPAC Name | 2,5-dibromo-3,6-bis-(4-methylphenyl)sulfonylcyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(Br)C(=O)C(S(=O)(=O)c3ccc(C)cc3)=C(Br)C2=O)cc1 |
| InChI | InChI=1S/C20H14Br2O6S2/c1-11-3-7-13(8-4-11)29(25,26)19-15(21)18(24)20(16(22)17(19)23)30(27,28)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | CFRIKYUWAOQJPO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|