About 1-bromo-4-methylbenzene;trihydrofluoride
1-bromo-4-methylbenzene;trihydrofluoride (PubChem CID 172815118) has the molecular formula C7H10BrF3
and a molecular weight of 231.06 g/mol. Its IUPAC name is 1-bromo-4-methylbenzene;trihydrofluoride.
Molecular Properties
| Compound Name | 1-bromo-4-methylbenzene;trihydrofluoride |
| PubChem CID | 172815118 |
| Molecular Formula | C7H10BrF3 |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 1-bromo-4-methylbenzene;trihydrofluoride |
| SMILES | Cc1ccc(Br)cc1.F.F.F |
| InChI | InChI=1S/C7H7Br.3FH/c1-6-2-4-7(8)5-3-6;;;/h2-5H,1H3;3*1H |
| InChIKey | SSBJOOLBHDYCJX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-4-methylbenzene;trihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylbenzene;trihydrofluoride?
The IUPAC name of 1-bromo-4-methylbenzene;trihydrofluoride (CID 172815118) is 1-bromo-4-methylbenzene;trihydrofluoride.
What is the SMILES notation for 1-bromo-4-methylbenzene;trihydrofluoride?
The canonical SMILES for 1-bromo-4-methylbenzene;trihydrofluoride is Cc1ccc(Br)cc1.F.F.F.
What is the InChIKey of 1-bromo-4-methylbenzene;trihydrofluoride?
The InChIKey is SSBJOOLBHDYCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br.3FH/c1-6-2-4-7(8)5-3-6;;;/h2-5H,1H3;3*1H.
What are the key properties of 1-bromo-4-methylbenzene;trihydrofluoride?
1-bromo-4-methylbenzene;trihydrofluoride has a molecular weight of 231.06 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylbenzene;trihydrofluoride is sourced from PubChem (CID 172815118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).