About 1-bromo-4-methylbenzene;methylsulfinylmethane
1-bromo-4-methylbenzene;methylsulfinylmethane (PubChem CID 68778706) has the molecular formula C9H13BrOS
and a molecular weight of 249.17 g/mol. Its IUPAC name is 1-bromo-4-methylbenzene;methylsulfinylmethane.
Molecular Properties
| Compound Name | 1-bromo-4-methylbenzene;methylsulfinylmethane |
| PubChem CID | 68778706 |
| Molecular Formula | C9H13BrOS |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 1-bromo-4-methylbenzene;methylsulfinylmethane |
| SMILES | CS(C)=O.Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C7H7Br.C2H6OS/c1-6-2-4-7(8)5-3-6;1-4(2)3/h2-5H,1H3;1-2H3 |
| InChIKey | SFZQTVUIIXWQPA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-methylbenzene;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylbenzene;methylsulfinylmethane?
The IUPAC name of 1-bromo-4-methylbenzene;methylsulfinylmethane (CID 68778706) is 1-bromo-4-methylbenzene;methylsulfinylmethane.
What is the SMILES notation for 1-bromo-4-methylbenzene;methylsulfinylmethane?
The canonical SMILES for 1-bromo-4-methylbenzene;methylsulfinylmethane is CS(C)=O.Cc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-methylbenzene;methylsulfinylmethane?
The InChIKey is SFZQTVUIIXWQPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br.C2H6OS/c1-6-2-4-7(8)5-3-6;1-4(2)3/h2-5H,1H3;1-2H3.
What are the key properties of 1-bromo-4-methylbenzene;methylsulfinylmethane?
1-bromo-4-methylbenzene;methylsulfinylmethane has a molecular weight of 249.17 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylbenzene;methylsulfinylmethane is sourced from PubChem (CID 68778706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).