C46H36Br2 — CID 132604288
1,4-bis(4-bromophenyl)-2,3,5,6-tetrakis(4-methylphenyl)benzene (PubChem CID 132604288) has the molecular formula C46H36Br2 and a molecular weight of 748.60 g/mol. Its IUPAC name is 1,4-bis(4-bromophenyl)-2,3,5,6-tetrakis(4-methylphenyl)benzene.
| Compound Name | 1,4-bis(4-bromophenyl)-2,3,5,6-tetrakis(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 132604288 |
| Molecular Formula | C46H36Br2 |
| Molecular Weight | 748.60 g/mol |
| Exact Mass | 746.12 |
| IUPAC Name | 1,4-bis(4-bromophenyl)-2,3,5,6-tetrakis(4-methylphenyl)benzene |
| SMILES | Cc1ccc(-c2c(-c3ccc(C)cc3)c(-c3ccc(Br)cc3)c(-c3ccc(C)cc3)c(-c3ccc(C)cc3)c2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C46H36Br2/c1-29-5-13-33(14-6-29)41-42(34-15-7-30(2)8-16-34)46(38-23-27-40(48)28-24-38)44(36-19-11-32(4)12-20-36)43(35-17-9-31(3)10-18-35)45(41)37-21-25-39(47)26-22-37/h5-28H,1-4H3 |
| InChIKey | XYPNGAXXCPUTAM-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.60 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |