C16H16O3S — CID 13140763
1-[(E)-2-(4-methoxyphenyl)ethenyl]sulfonyl-4-methylbenzene (PubChem CID 13140763) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-[(E)-2-(4-methoxyphenyl)ethenyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[(E)-2-(4-methoxyphenyl)ethenyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 13140763 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-[(E)-2-(4-methoxyphenyl)ethenyl]sulfonyl-4-methylbenzene |
| SMILES | COc1ccc(/C=C/S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H16O3S/c1-13-3-9-16(10-4-13)20(17,18)12-11-14-5-7-15(19-2)8-6-14/h3-12H,1-2H3/b12-11+ |
| InChIKey | URHYHHAUTHFCCA-VAWYXSNFSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |