C22H29NO3S — CID 121254637
N-[(E)-5-(4-methoxyphenyl)-2-propan-2-ylpent-4-enyl]-4-methylbenzenesulfonamide (PubChem CID 121254637) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is N-[(E)-5-(4-methoxyphenyl)-2-propan-2-ylpent-4-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-5-(4-methoxyphenyl)-2-propan-2-ylpent-4-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 121254637 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[(E)-5-(4-methoxyphenyl)-2-propan-2-ylpent-4-enyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(/C=C/CC(CNS(=O)(=O)c2ccc(C)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-17(2)20(7-5-6-19-10-12-21(26-4)13-11-19)16-23-27(24,25)22-14-8-18(3)9-15-22/h5-6,8-15,17,20,23H,7,16H2,1-4H3/b6-5+ |
| InChIKey | NXYWYFLWNBFNGE-AATRIKPKSA-N |
| XLogP | 4.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |