C27H30N2O5S — CID 102149339
methyl (E,2S,3R)-3-(4-methoxyanilino)-2-[[(4-methylphenyl)sulfonylamino]methyl]-5-phenylpent-4-enoate (PubChem CID 102149339) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is methyl (E,2S,3R)-3-(4-methoxyanilino)-2-[[(4-methylphenyl)sulfonylamino]methyl]-5-phenylpent-4-enoate.
| Compound Name | methyl (E,2S,3R)-3-(4-methoxyanilino)-2-[[(4-methylphenyl)sulfonylamino]methyl]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 102149339 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | methyl (E,2S,3R)-3-(4-methoxyanilino)-2-[[(4-methylphenyl)sulfonylamino]methyl]-5-phenylpent-4-enoate |
| SMILES | COC(=O)[C@@H](CNS(=O)(=O)c1ccc(C)cc1)[C@@H](/C=C/c1ccccc1)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c1-20-9-16-24(17-10-20)35(31,32)28-19-25(27(30)34-3)26(18-11-21-7-5-4-6-8-21)29-22-12-14-23(33-2)15-13-22/h4-18,25-26,28-29H,19H2,1-3H3/b18-11+/t25-,26+/m0/s1 |
| InChIKey | DOMIDRQXVVRJLH-UNQBSXFESA-N |
| XLogP | 4.27 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|