C28H34O3SSi — CID 15935893
[(E)-1-(benzenesulfonyl)-4-methylpent-1-en-3-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 15935893) has the molecular formula C28H34O3SSi and a molecular weight of 478.73 g/mol. Its IUPAC name is [(E)-1-(benzenesulfonyl)-4-methylpent-1-en-3-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(E)-1-(benzenesulfonyl)-4-methylpent-1-en-3-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 15935893 |
| Molecular Formula | C28H34O3SSi |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(E)-1-(benzenesulfonyl)-4-methylpent-1-en-3-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)C(/C=C/S(=O)(=O)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H34O3SSi/c1-23(2)27(21-22-32(29,30)24-15-9-6-10-16-24)31-33(28(3,4)5,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-23,27H,1-5H3/b22-21+ |
| InChIKey | BLBWXJKGZZQXIA-QURGRASLSA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|