C22H28Br2OSi — CID 59466620
tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-diphenylsilane (PubChem CID 59466620) has the molecular formula C22H28Br2OSi and a molecular weight of 496.36 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 59466620 |
| Molecular Formula | C22H28Br2OSi |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-diphenylsilane |
| SMILES | C[C@H](C=C(Br)Br)[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H28Br2OSi/c1-17(16-21(23)24)18(2)25-26(22(3,4)5,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-18H,1-5H3/t17-,18-/m1/s1 |
| InChIKey | JOZHQNFMKIVKCN-QZTJIDSGSA-N |
| XLogP | 6.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|