C27H34O2Si — CID 134831581
tert-butyl-[(2R,3S)-3-methoxy-4-phenylbutan-2-yl]oxy-diphenylsilane (PubChem CID 134831581) has the molecular formula C27H34O2Si and a molecular weight of 418.65 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-3-methoxy-4-phenylbutan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3S)-3-methoxy-4-phenylbutan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 134831581 |
| Molecular Formula | C27H34O2Si |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl-[(2R,3S)-3-methoxy-4-phenylbutan-2-yl]oxy-diphenylsilane |
| SMILES | CO[C@@H](Cc1ccccc1)[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H34O2Si/c1-22(26(28-5)21-23-15-9-6-10-16-23)29-30(27(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,22,26H,21H2,1-5H3/t22-,26+/m1/s1 |
| InChIKey | UKPAOTFQGKTLFJ-GJZUVCINSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|