C12H16O3S — CID 14785606
(E,3R)-1-(benzenesulfonyl)-4-methylpent-1-en-3-ol (PubChem CID 14785606) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is (E,3R)-1-(benzenesulfonyl)-4-methylpent-1-en-3-ol.
| Compound Name | (E,3R)-1-(benzenesulfonyl)-4-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 14785606 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (E,3R)-1-(benzenesulfonyl)-4-methylpent-1-en-3-ol |
| SMILES | CC(C)[C@@H](O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O3S/c1-10(2)12(13)8-9-16(14,15)11-6-4-3-5-7-11/h3-10,12-13H,1-2H3/b9-8+/t12-/m0/s1 |
| InChIKey | PEXSLQWTOBMNTD-BCPZQOPPSA-N |
| XLogP | 1.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |