C15H18O3S — CID 101073794
(E)-1-(benzenesulfonyl)-4,4-dimethylhept-1-en-6-yn-3-ol (PubChem CID 101073794) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is (E)-1-(benzenesulfonyl)-4,4-dimethylhept-1-en-6-yn-3-ol.
| Compound Name | (E)-1-(benzenesulfonyl)-4,4-dimethylhept-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 101073794 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (E)-1-(benzenesulfonyl)-4,4-dimethylhept-1-en-6-yn-3-ol |
| SMILES | C#CCC(C)(C)C(O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O3S/c1-4-11-15(2,3)14(16)10-12-19(17,18)13-8-6-5-7-9-13/h1,5-10,12,14,16H,11H2,2-3H3/b12-10+ |
| InChIKey | KFJHEBAGGQNJFZ-ZRDIBKRKSA-N |
| XLogP | 2.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|