C16H27NO3Si — CID 11141410
tert-butyl-dimethyl-[(1S)-4-nitro-1-phenylbutoxy]silane (PubChem CID 11141410) has the molecular formula C16H27NO3Si and a molecular weight of 309.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S)-4-nitro-1-phenylbutoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1S)-4-nitro-1-phenylbutoxy]silane |
|---|---|
| PubChem CID | 11141410 |
| Molecular Formula | C16H27NO3Si |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | tert-butyl-dimethyl-[(1S)-4-nitro-1-phenylbutoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCC[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H27NO3Si/c1-16(2,3)21(4,5)20-15(12-9-13-17(18)19)14-10-7-6-8-11-14/h6-8,10-11,15H,9,12-13H2,1-5H3/t15-/m0/s1 |
| InChIKey | VKMGYAWNOSMQCK-HNNXBMFYSA-N |
| XLogP | 4.81 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|