C15H26O3Si — CID 101141021
4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]phenol (PubChem CID 101141021) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is 4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]phenol.
| Compound Name | 4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]phenol |
|---|---|
| PubChem CID | 101141021 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCO)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H26O3Si/c1-15(2,3)19(4,5)18-14(10-11-16)12-6-8-13(17)9-7-12/h6-9,14,16-17H,10-11H2,1-5H3/t14-/m1/s1 |
| InChIKey | LVMGSAAALGKTTB-CQSZACIVSA-N |
| XLogP | 3.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|