C36H60O4Si2 — CID 101142293
2-[4-[(E)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[4-(2-hydroxyethyl)phenyl]oct-4-enyl]phenyl]ethanol (PubChem CID 101142293) has the molecular formula C36H60O4Si2 and a molecular weight of 613.04 g/mol. Its IUPAC name is 2-[4-[(E)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[4-(2-hydroxyethyl)phenyl]oct-4-enyl]phenyl]ethanol.
| Compound Name | 2-[4-[(E)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[4-(2-hydroxyethyl)phenyl]oct-4-enyl]phenyl]ethanol |
|---|---|
| PubChem CID | 101142293 |
| Molecular Formula | C36H60O4Si2 |
| Molecular Weight | 613.04 g/mol |
| Exact Mass | 612.40 |
| IUPAC Name | 2-[4-[(E)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]-8-[4-(2-hydroxyethyl)phenyl]oct-4-enyl]phenyl]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC/C=C/CCC(O[Si](C)(C)C(C)(C)C)c1ccc(CCO)cc1)c1ccc(CCO)cc1 |
| InChI | InChI=1S/C36H60O4Si2/c1-35(2,3)41(7,8)39-33(31-21-17-29(18-22-31)25-27-37)15-13-11-12-14-16-34(40-42(9,10)36(4,5)6)32-23-19-30(20-24-32)26-28-38/h11-12,17-24,33-34,37-38H,13-16,25-28H2,1-10H3/b12-11+ |
| InChIKey | HQPPYDUCLBFVJG-VAWYXSNFSA-N |
| XLogP | 9.70 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.04 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|