C16H30O3Si — CID 11415303
6-[tert-butyl(dimethyl)silyl]oxy-6-(furan-2-yl)hexan-1-ol (PubChem CID 11415303) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-6-(furan-2-yl)hexan-1-ol.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-6-(furan-2-yl)hexan-1-ol |
|---|---|
| PubChem CID | 11415303 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-6-(furan-2-yl)hexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCCCO)c1ccco1 |
| InChI | InChI=1S/C16H30O3Si/c1-16(2,3)20(4,5)19-15(10-7-6-8-12-17)14-11-9-13-18-14/h9,11,13,15,17H,6-8,10,12H2,1-5H3 |
| InChIKey | WJLWNIOCYBTTDK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|