C15H26O4SSi — CID 14930975
S-ethyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-hydroxypropanethioate (PubChem CID 14930975) has the molecular formula C15H26O4SSi and a molecular weight of 330.52 g/mol. Its IUPAC name is S-ethyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-hydroxypropanethioate.
| Compound Name | S-ethyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-hydroxypropanethioate |
|---|---|
| PubChem CID | 14930975 |
| Molecular Formula | C15H26O4SSi |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | S-ethyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-hydroxypropanethioate |
| SMILES | CCSC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)c1ccco1 |
| InChI | InChI=1S/C15H26O4SSi/c1-7-20-14(17)13(12(16)11-9-8-10-18-11)19-21(5,6)15(2,3)4/h8-10,12-13,16H,7H2,1-6H3/t12-,13+/m1/s1 |
| InChIKey | IJJCTBQLKZLFOF-OLZOCXBDSA-N |
| XLogP | 3.98 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|