C13H23N3O3Si — CID 10979398
(1R,2S)-1-azido-3-[tert-butyl(dimethyl)silyl]oxy-1-(furan-2-yl)propan-2-ol (PubChem CID 10979398) has the molecular formula C13H23N3O3Si and a molecular weight of 297.43 g/mol. Its IUPAC name is (1R,2S)-1-azido-3-[tert-butyl(dimethyl)silyl]oxy-1-(furan-2-yl)propan-2-ol.
| Compound Name | (1R,2S)-1-azido-3-[tert-butyl(dimethyl)silyl]oxy-1-(furan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 10979398 |
| Molecular Formula | C13H23N3O3Si |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (1R,2S)-1-azido-3-[tert-butyl(dimethyl)silyl]oxy-1-(furan-2-yl)propan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](N=[N+]=[N-])c1ccco1 |
| InChI | InChI=1S/C13H23N3O3Si/c1-13(2,3)20(4,5)19-9-10(17)12(15-16-14)11-7-6-8-18-11/h6-8,10,12,17H,9H2,1-5H3/t10-,12-/m1/s1 |
| InChIKey | WHNMXDNOXAMFSZ-ZYHUDNBSSA-N |
| XLogP | 4.01 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|