C13H29N3O4Si — CID 57239687
(2R,3R)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentan-2-ol (PubChem CID 57239687) has the molecular formula C13H29N3O4Si and a molecular weight of 319.48 g/mol. Its IUPAC name is (2R,3R)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentan-2-ol.
| Compound Name | (2R,3R)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentan-2-ol |
|---|---|
| PubChem CID | 57239687 |
| Molecular Formula | C13H29N3O4Si |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (2R,3R)-3-azido-1-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentan-2-ol |
| SMILES | COC(C[C@@H](N=[N+]=[N-])[C@@H](O)CO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C13H29N3O4Si/c1-13(2,3)21(6,7)20-9-11(17)10(15-16-14)8-12(18-4)19-5/h10-12,17H,8-9H2,1-7H3/t10-,11+/m1/s1 |
| InChIKey | IWAYNMKZOZZDCF-MNOVXSKESA-N |
| XLogP | 3.06 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|