C15H32F2N3O4PSi — CID 10549776
[(2S,3R)-2-azido-4-diethoxyphosphoryl-4,4-difluoro-3-methylbutoxy]-tert-butyl-dimethylsilane (PubChem CID 10549776) has the molecular formula C15H32F2N3O4PSi and a molecular weight of 415.49 g/mol. Its IUPAC name is [(2S,3R)-2-azido-4-diethoxyphosphoryl-4,4-difluoro-3-methylbutoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R)-2-azido-4-diethoxyphosphoryl-4,4-difluoro-3-methylbutoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10549776 |
| Molecular Formula | C15H32F2N3O4PSi |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | [(2S,3R)-2-azido-4-diethoxyphosphoryl-4,4-difluoro-3-methylbutoxy]-tert-butyl-dimethylsilane |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H](C)[C@@H](CO[Si](C)(C)C(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C15H32F2N3O4PSi/c1-9-22-25(21,23-10-2)15(16,17)12(3)13(19-20-18)11-24-26(7,8)14(4,5)6/h12-13H,9-11H2,1-8H3/t12-,13-/m1/s1 |
| InChIKey | FGZWKSMCYVKETN-CHWSQXEVSA-N |
| XLogP | 6.18 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|