C15H35O5PSi — CID 57166590
1-[tert-butyl(dimethyl)silyl]oxy-4-[ethoxy(propyl)phosphoryl]oxybutan-2-ol (PubChem CID 57166590) has the molecular formula C15H35O5PSi and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-4-[ethoxy(propyl)phosphoryl]oxybutan-2-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-4-[ethoxy(propyl)phosphoryl]oxybutan-2-ol |
|---|---|
| PubChem CID | 57166590 |
| Molecular Formula | C15H35O5PSi |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-4-[ethoxy(propyl)phosphoryl]oxybutan-2-ol |
| SMILES | CCCP(=O)(OCC)OCCC(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H35O5PSi/c1-8-12-21(17,18-9-2)19-11-10-14(16)13-20-22(6,7)15(3,4)5/h14,16H,8-13H2,1-7H3 |
| InChIKey | JSGBZPAXZWWJFA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|