C12H27NO4Si — CID 11514635
(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-2-nitrohexan-3-ol (PubChem CID 11514635) has the molecular formula C12H27NO4Si and a molecular weight of 277.44 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-2-nitrohexan-3-ol.
| Compound Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-2-nitrohexan-3-ol |
|---|---|
| PubChem CID | 11514635 |
| Molecular Formula | C12H27NO4Si |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-2-nitrohexan-3-ol |
| SMILES | CCC[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H27NO4Si/c1-7-8-11(14)10(13(15)16)9-17-18(5,6)12(2,3)4/h10-11,14H,7-9H2,1-6H3/t10-,11-/m1/s1 |
| InChIKey | CXBHOLNBBDOSGH-GHMZBOCLSA-N |
| XLogP | 2.81 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|