C20H42O8Si — CID 158562183
ethyl 5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxypentanoate;ethyl 4,5-dihydroxypentanoate (PubChem CID 158562183) has the molecular formula C20H42O8Si and a molecular weight of 438.63 g/mol. Its IUPAC name is ethyl 5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxypentanoate;ethyl 4,5-dihydroxypentanoate.
| Compound Name | ethyl 5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxypentanoate;ethyl 4,5-dihydroxypentanoate |
|---|---|
| PubChem CID | 158562183 |
| Molecular Formula | C20H42O8Si |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | ethyl 5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxypentanoate;ethyl 4,5-dihydroxypentanoate |
| SMILES | CCOC(=O)CCC(O)CO.CCOC(=O)CCC(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O4Si.C7H14O4/c1-7-16-12(15)9-8-11(14)10-17-18(5,6)13(2,3)4;1-2-11-7(10)4-3-6(9)5-8/h11,14H,7-10H2,1-6H3;6,8-9H,2-5H2,1H3 |
| InChIKey | HRADRTTZIIIYNJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|