C25H54O5Si2 — CID 102469145
ethyl (4R,7S,8S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-4,8-dimethylnonanoate (PubChem CID 102469145) has the molecular formula C25H54O5Si2 and a molecular weight of 490.87 g/mol. Its IUPAC name is ethyl (4R,7S,8S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-4,8-dimethylnonanoate.
| Compound Name | ethyl (4R,7S,8S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-4,8-dimethylnonanoate |
|---|---|
| PubChem CID | 102469145 |
| Molecular Formula | C25H54O5Si2 |
| Molecular Weight | 490.87 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | ethyl (4R,7S,8S)-7,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-4,8-dimethylnonanoate |
| SMILES | CCOC(=O)CC(O)[C@H](C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O5Si2/c1-14-28-23(27)17-21(26)19(2)15-16-22(30-32(12,13)25(7,8)9)20(3)18-29-31(10,11)24(4,5)6/h19-22,26H,14-18H2,1-13H3/t19-,20+,21?,22+/m1/s1 |
| InChIKey | LGEWWMZTVQDKBH-PUZDIZQLSA-N |
| XLogP | 6.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.87 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|