C17H36O4Si — CID 11174970
ethyl (3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethylheptanoate (PubChem CID 11174970) has the molecular formula C17H36O4Si and a molecular weight of 332.56 g/mol. Its IUPAC name is ethyl (3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethylheptanoate.
| Compound Name | ethyl (3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethylheptanoate |
|---|---|
| PubChem CID | 11174970 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | ethyl (3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethylheptanoate |
| SMILES | CCOC(=O)C[C@H](O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H36O4Si/c1-10-20-15(19)11-14(18)13(4)16(12(2)3)21-22(8,9)17(5,6)7/h12-14,16,18H,10-11H2,1-9H3/t13-,14+,16+/m1/s1 |
| InChIKey | SJMDAWFONCAZQF-YCPHGPKFSA-N |
| XLogP | 3.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|