C21H23F7O3Si — CID 177466391
ethyl 3-[tert-butyl(dimethyl)silyl]oxy-3-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)propanoate (PubChem CID 177466391) has the molecular formula C21H23F7O3Si and a molecular weight of 484.48 g/mol. Its IUPAC name is ethyl 3-[tert-butyl(dimethyl)silyl]oxy-3-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)propanoate.
| Compound Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-3-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 177466391 |
| Molecular Formula | C21H23F7O3Si |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-3-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)propanoate |
| SMILES | CCOC(=O)CC(O[Si](C)(C)C(C)(C)C)c1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C21H23F7O3Si/c1-7-30-10(29)8-9(31-32(5,6)21(2,3)4)11-14(22)12-13(16(24)15(11)23)18(26)20(28)19(27)17(12)25/h9H,7-8H2,1-6H3 |
| InChIKey | YQEQLYBJNYYJQB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|