C11H9F5O3 — CID 24974654
ethyl 3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate (PubChem CID 24974654) has the molecular formula C11H9F5O3 and a molecular weight of 284.18 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate.
| Compound Name | ethyl 3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
|---|---|
| PubChem CID | 24974654 |
| Molecular Formula | C11H9F5O3 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | ethyl 3-hydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
| SMILES | CCOC(=O)CC(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H9F5O3/c1-2-19-5(18)3-4(17)6-7(12)9(14)11(16)10(15)8(6)13/h4,17H,2-3H2,1H3 |
| InChIKey | BVIUJBDWUGVDPA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|