C12H12F5NO3 — CID 103260878
ethyl 3-hydroxy-4-(2,3,4,5,6-pentafluoroanilino)butanoate (PubChem CID 103260878) has the molecular formula C12H12F5NO3 and a molecular weight of 313.22 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-(2,3,4,5,6-pentafluoroanilino)butanoate.
| Compound Name | ethyl 3-hydroxy-4-(2,3,4,5,6-pentafluoroanilino)butanoate |
|---|---|
| PubChem CID | 103260878 |
| Molecular Formula | C12H12F5NO3 |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | ethyl 3-hydroxy-4-(2,3,4,5,6-pentafluoroanilino)butanoate |
| SMILES | CCOC(=O)CC(O)CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NO3/c1-2-21-6(20)3-5(19)4-18-12-10(16)8(14)7(13)9(15)11(12)17/h5,18-19H,2-4H2,1H3 |
| InChIKey | ATNOPGNVUSOKQM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|