C10H10F5NO — CID 115564312
1-(2,3,4,5,6-pentafluoroanilino)butan-2-ol (PubChem CID 115564312) has the molecular formula C10H10F5NO and a molecular weight of 255.19 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluoroanilino)butan-2-ol.
| Compound Name | 1-(2,3,4,5,6-pentafluoroanilino)butan-2-ol |
|---|---|
| PubChem CID | 115564312 |
| Molecular Formula | C10H10F5NO |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluoroanilino)butan-2-ol |
| SMILES | CCC(O)CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F5NO/c1-2-4(17)3-16-10-8(14)6(12)5(11)7(13)9(10)15/h4,16-17H,2-3H2,1H3 |
| InChIKey | IUUOSEHXINYPEA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|