About ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate
ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate (PubChem CID 103246903) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate.
Analyze ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate?
The IUPAC name of ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate (CID 103246903) is ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate.
What is the SMILES notation for ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate?
The canonical SMILES for ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate is CCOC(=O)CC(O)CNC(C)(C)CC(C)(C)C.
What is the InChIKey of ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate?
The InChIKey is WFBPTASYDDJTRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO3/c1-7-18-12(17)8-11(16)9-15-14(5,6)10-13(2,3)4/h11,15-16H,7-10H2,1-6H3.
What are the key properties of ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate?
ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate has a molecular weight of 259.39 g/mol, XLogP of 2.10, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxy-4-(2,4,4-trimethylpentan-2-ylamino)butanoate is sourced from PubChem (CID 103246903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).