C13H29NO2 — CID 63934217
1-ethoxy-3-(2,4,4-trimethylpentan-2-ylamino)propan-2-ol (PubChem CID 63934217) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-ethoxy-3-(2,4,4-trimethylpentan-2-ylamino)propan-2-ol.
| Compound Name | 1-ethoxy-3-(2,4,4-trimethylpentan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 63934217 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 1-ethoxy-3-(2,4,4-trimethylpentan-2-ylamino)propan-2-ol |
| SMILES | CCOCC(O)CNC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C13H29NO2/c1-7-16-9-11(15)8-14-13(5,6)10-12(2,3)4/h11,14-15H,7-10H2,1-6H3 |
| InChIKey | MIEAQAHGKHUBCZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |