C19H31NO4Si — CID 10937422
ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methoxyphenyl)iminobutanoate (PubChem CID 10937422) has the molecular formula C19H31NO4Si and a molecular weight of 365.55 g/mol. Its IUPAC name is ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methoxyphenyl)iminobutanoate.
| Compound Name | ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methoxyphenyl)iminobutanoate |
|---|---|
| PubChem CID | 10937422 |
| Molecular Formula | C19H31NO4Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methoxyphenyl)iminobutanoate |
| SMILES | CCOC(=O)C[C@@H](/C=N/c1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H31NO4Si/c1-8-23-18(21)13-17(24-25(6,7)19(2,3)4)14-20-15-9-11-16(22-5)12-10-15/h9-12,14,17H,8,13H2,1-7H3/b20-14+/t17-/m0/s1 |
| InChIKey | ZSRFCXMEAPGEHS-TYSUYXETSA-N |
| XLogP | 4.74 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|