C25H34O5Si — CID 11154956
(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(4-methoxyphenyl)-5-oxopentanal (PubChem CID 11154956) has the molecular formula C25H34O5Si and a molecular weight of 442.63 g/mol. Its IUPAC name is (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(4-methoxyphenyl)-5-oxopentanal.
| Compound Name | (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(4-methoxyphenyl)-5-oxopentanal |
|---|---|
| PubChem CID | 11154956 |
| Molecular Formula | C25H34O5Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3,5-bis(4-methoxyphenyl)-5-oxopentanal |
| SMILES | COc1ccc(C(=O)C[C@@H](c2ccc(OC)cc2)[C@@H](C=O)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H34O5Si/c1-25(2,3)31(6,7)30-24(17-26)22(18-8-12-20(28-4)13-9-18)16-23(27)19-10-14-21(29-5)15-11-19/h8-15,17,22,24H,16H2,1-7H3/t22-,24+/m0/s1 |
| InChIKey | SHXGLGHBMUGHOS-LADGPHEKSA-N |
| XLogP | 5.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|