C28H48O3Si — CID 101376484
(E)-1-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)pentadec-4-en-3-one (PubChem CID 101376484) has the molecular formula C28H48O3Si and a molecular weight of 460.78 g/mol. Its IUPAC name is (E)-1-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)pentadec-4-en-3-one.
| Compound Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)pentadec-4-en-3-one |
|---|---|
| PubChem CID | 101376484 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)pentadec-4-en-3-one |
| SMILES | CCCCCCCCCC/C=C/C(=O)CC(O[Si](C)(C)C(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H48O3Si/c1-8-9-10-11-12-13-14-15-16-17-18-25(29)23-27(31-32(6,7)28(2,3)4)24-19-21-26(30-5)22-20-24/h17-22,27H,8-16,23H2,1-7H3/b18-17+ |
| InChIKey | DSHMLEFCAMQOQE-ISLYRVAYSA-N |
| XLogP | 8.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|