C25H36O3Si — CID 11090934
methyl (E)-8-[tert-butyl(dimethyl)silyl]oxy-8-naphthalen-2-yloct-2-enoate (PubChem CID 11090934) has the molecular formula C25H36O3Si and a molecular weight of 412.65 g/mol. Its IUPAC name is methyl (E)-8-[tert-butyl(dimethyl)silyl]oxy-8-naphthalen-2-yloct-2-enoate.
| Compound Name | methyl (E)-8-[tert-butyl(dimethyl)silyl]oxy-8-naphthalen-2-yloct-2-enoate |
|---|---|
| PubChem CID | 11090934 |
| Molecular Formula | C25H36O3Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | methyl (E)-8-[tert-butyl(dimethyl)silyl]oxy-8-naphthalen-2-yloct-2-enoate |
| SMILES | COC(=O)/C=C/CCCCC(O[Si](C)(C)C(C)(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H36O3Si/c1-25(2,3)29(5,6)28-23(15-9-7-8-10-16-24(26)27-4)22-18-17-20-13-11-12-14-21(20)19-22/h10-14,16-19,23H,7-9,15H2,1-6H3/b16-10+ |
| InChIKey | NHVUBUQBBIIVCU-MHWRWJLKSA-N |
| XLogP | 7.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|