C22H36O4Si — CID 11101270
methyl (E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-6-methyl-8-phenyloct-2-enoate (PubChem CID 11101270) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is methyl (E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-6-methyl-8-phenyloct-2-enoate.
| Compound Name | methyl (E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-6-methyl-8-phenyloct-2-enoate |
|---|---|
| PubChem CID | 11101270 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | methyl (E,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-6-methyl-8-phenyloct-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CC(O)c1ccccc1 |
| InChI | InChI=1S/C22H36O4Si/c1-17(16-19(23)18-12-9-8-10-13-18)20(14-11-15-21(24)25-5)26-27(6,7)22(2,3)4/h8-13,15,17,19-20,23H,14,16H2,1-7H3/b15-11+/t17-,19?,20+/m1/s1 |
| InChIKey | XRXRCXOQPIRLFR-LGNQCDPKSA-N |
| XLogP | 5.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|