C23H36O5Si — CID 11811871
methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]pent-2-enoate (PubChem CID 11811871) has the molecular formula C23H36O5Si and a molecular weight of 420.62 g/mol. Its IUPAC name is methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]pent-2-enoate.
| Compound Name | methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]pent-2-enoate |
|---|---|
| PubChem CID | 11811871 |
| Molecular Formula | C23H36O5Si |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]pent-2-enoate |
| SMILES | COC(=O)/C=C\C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H36O5Si/c1-22(2,3)29(7,8)28-18(15-12-16-19(24)25-6)21-20(26-23(4,5)27-21)17-13-10-9-11-14-17/h9-14,16,18,20-21H,15H2,1-8H3/b16-12-/t18-,20+,21+/m1/s1 |
| InChIKey | JBUCFSQBWPNKJW-LPUCSLFLSA-N |
| XLogP | 5.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|